C28H31N3OS — CID 22236122
2-[4-[4-[(benzylamino)methyl]phenyl]phenyl]sulfanyl-N-(cyanomethyl)-4-methylpentanamide (PubChem CID 22236122) has the molecular formula C28H31N3OS and a molecular weight of 457.64 g/mol. Its IUPAC name is 2-[4-[4-[(benzylamino)methyl]phenyl]phenyl]sulfanyl-N-(cyanomethyl)-4-methylpentanamide.
| Compound Name | 2-[4-[4-[(benzylamino)methyl]phenyl]phenyl]sulfanyl-N-(cyanomethyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 22236122 |
| Molecular Formula | C28H31N3OS |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 2-[4-[4-[(benzylamino)methyl]phenyl]phenyl]sulfanyl-N-(cyanomethyl)-4-methylpentanamide |
| SMILES | CC(C)CC(Sc1ccc(-c2ccc(CNCc3ccccc3)cc2)cc1)C(=O)NCC#N |
| InChI | InChI=1S/C28H31N3OS/c1-21(2)18-27(28(32)31-17-16-29)33-26-14-12-25(13-15-26)24-10-8-23(9-11-24)20-30-19-22-6-4-3-5-7-22/h3-15,21,27,30H,17-20H2,1-2H3,(H,31,32) |
| InChIKey | TXRSRHWGAAQBCS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|