C22H24N3O3S- — CID 22235913
N-[[4-[4-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]sulfanylphenyl]phenyl]methyl]carbamate (PubChem CID 22235913) has the molecular formula C22H24N3O3S- and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[[4-[4-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]sulfanylphenyl]phenyl]methyl]carbamate.
| Compound Name | N-[[4-[4-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]sulfanylphenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 22235913 |
| Molecular Formula | C22H24N3O3S- |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N-[[4-[4-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]sulfanylphenyl]phenyl]methyl]carbamate |
| SMILES | CC(C)CC(Sc1ccc(-c2ccc(CNC(=O)[O-])cc2)cc1)C(=O)NCC#N |
| InChI | InChI=1S/C22H25N3O3S/c1-15(2)13-20(21(26)24-12-11-23)29-19-9-7-18(8-10-19)17-5-3-16(4-6-17)14-25-22(27)28/h3-10,15,20,25H,12-14H2,1-2H3,(H,24,26)(H,27,28)/p-1 |
| InChIKey | QBYVVEFCRRLQDD-UHFFFAOYSA-M |
| XLogP | 2.93 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|