C25H31N3O3 — CID 18628712
tert-butyl N-[4-[3-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]phenyl]phenyl]carbamate (PubChem CID 18628712) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is tert-butyl N-[4-[3-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]phenyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]phenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 18628712 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | tert-butyl N-[4-[3-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]phenyl]phenyl]carbamate |
| SMILES | CC(C)CC(C(=O)NCC#N)c1cccc(-c2ccc(NC(=O)OC(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C25H31N3O3/c1-17(2)15-22(23(29)27-14-13-26)20-8-6-7-19(16-20)18-9-11-21(12-10-18)28-24(30)31-25(3,4)5/h6-12,16-17,22H,14-15H2,1-5H3,(H,27,29)(H,28,30) |
| InChIKey | SZWFNMJMEOKSRY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|