C27H36N4O3 — CID 172682550
4-[3-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]phenyl]benzoic acid;N,1-dimethylpyrrolidin-3-amine (PubChem CID 172682550) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is 4-[3-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]phenyl]benzoic acid;N,1-dimethylpyrrolidin-3-amine.
| Compound Name | 4-[3-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]phenyl]benzoic acid;N,1-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 172682550 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | 4-[3-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]phenyl]benzoic acid;N,1-dimethylpyrrolidin-3-amine |
| SMILES | CC(C)CC(C(=O)NCC#N)c1cccc(-c2ccc(C(=O)O)cc2)c1.CNC1CCN(C)C1 |
| InChI | InChI=1S/C21H22N2O3.C6H14N2/c1-14(2)12-19(20(24)23-11-10-22)18-5-3-4-17(13-18)15-6-8-16(9-7-15)21(25)26;1-7-6-3-4-8(2)5-6/h3-9,13-14,19H,11-12H2,1-2H3,(H,23,24)(H,25,26);6-7H,3-5H2,1-2H3 |
| InChIKey | APGULQGRLGXZEW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|