C27H36N4O4S — CID 10118463
N-(cyanomethyl)-4-methyl-2-[3-[4-(3-morpholin-4-ylpropylsulfamoyl)phenyl]phenyl]pentanamide (PubChem CID 10118463) has the molecular formula C27H36N4O4S and a molecular weight of 512.68 g/mol. Its IUPAC name is N-(cyanomethyl)-4-methyl-2-[3-[4-(3-morpholin-4-ylpropylsulfamoyl)phenyl]phenyl]pentanamide.
| Compound Name | N-(cyanomethyl)-4-methyl-2-[3-[4-(3-morpholin-4-ylpropylsulfamoyl)phenyl]phenyl]pentanamide |
|---|---|
| PubChem CID | 10118463 |
| Molecular Formula | C27H36N4O4S |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | N-(cyanomethyl)-4-methyl-2-[3-[4-(3-morpholin-4-ylpropylsulfamoyl)phenyl]phenyl]pentanamide |
| SMILES | CC(C)CC(C(=O)NCC#N)c1cccc(-c2ccc(S(=O)(=O)NCCCN3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C27H36N4O4S/c1-21(2)19-26(27(32)29-13-11-28)24-6-3-5-23(20-24)22-7-9-25(10-8-22)36(33,34)30-12-4-14-31-15-17-35-18-16-31/h3,5-10,20-21,26,30H,4,12-19H2,1-2H3,(H,29,32) |
| InChIKey | WHOKZHNRITYWPX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|