C26H33N3O3 — CID 87717486
tert-butyl N-[4-[3-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]phenyl]phenyl]-N-methylcarbamate (PubChem CID 87717486) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is tert-butyl N-[4-[3-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]phenyl]phenyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[3-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]phenyl]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 87717486 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | tert-butyl N-[4-[3-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]phenyl]phenyl]-N-methylcarbamate |
| SMILES | CC(C)CC(C(=O)NCC#N)c1cccc(-c2ccc(N(C)C(=O)OC(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C26H33N3O3/c1-18(2)16-23(24(30)28-15-14-27)21-9-7-8-20(17-21)19-10-12-22(13-11-19)29(6)25(31)32-26(3,4)5/h7-13,17-18,23H,15-16H2,1-6H3,(H,28,30) |
| InChIKey | DKSXUTWBJPNLJS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|