About N-(cyanomethyl)-2-[3-(4,5-dichloro-1H-imidazol-2-yl)phenyl]-4-methylpentanamide
N-(cyanomethyl)-2-[3-(4,5-dichloro-1H-imidazol-2-yl)phenyl]-4-methylpentanamide (PubChem CID 18628746) has the molecular formula C17H18Cl2N4O
and a molecular weight of 365.26 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[3-(4,5-dichloro-1H-imidazol-2-yl)phenyl]-4-methylpentanamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-2-[3-(4,5-dichloro-1H-imidazol-2-yl)phenyl]-4-methylpentanamide |
| PubChem CID | 18628746 |
| Molecular Formula | C17H18Cl2N4O |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-(cyanomethyl)-2-[3-(4,5-dichloro-1H-imidazol-2-yl)phenyl]-4-methylpentanamide |
| SMILES | CC(C)CC(C(=O)NCC#N)c1cccc(-c2nc(Cl)c(Cl)[nH]2)c1 |
| InChI | InChI=1S/C17H18Cl2N4O/c1-10(2)8-13(17(24)21-7-6-20)11-4-3-5-12(9-11)16-22-14(18)15(19)23-16/h3-5,9-10,13H,7-8H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | NZRLHCQRCCCGGU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-2-[3-(4,5-dichloro-1H-imidazol-2-yl)phenyl]-4-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-2-[3-(4,5-dichloro-1H-imidazol-2-yl)phenyl]-4-methylpentanamide?
The IUPAC name of N-(cyanomethyl)-2-[3-(4,5-dichloro-1H-imidazol-2-yl)phenyl]-4-methylpentanamide (CID 18628746) is N-(cyanomethyl)-2-[3-(4,5-dichloro-1H-imidazol-2-yl)phenyl]-4-methylpentanamide.
What is the SMILES notation for N-(cyanomethyl)-2-[3-(4,5-dichloro-1H-imidazol-2-yl)phenyl]-4-methylpentanamide?
The canonical SMILES for N-(cyanomethyl)-2-[3-(4,5-dichloro-1H-imidazol-2-yl)phenyl]-4-methylpentanamide is CC(C)CC(C(=O)NCC#N)c1cccc(-c2nc(Cl)c(Cl)[nH]2)c1.
What is the InChIKey of N-(cyanomethyl)-2-[3-(4,5-dichloro-1H-imidazol-2-yl)phenyl]-4-methylpentanamide?
The InChIKey is NZRLHCQRCCCGGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Cl2N4O/c1-10(2)8-13(17(24)21-7-6-20)11-4-3-5-12(9-11)16-22-14(18)15(19)23-16/h3-5,9-10,13H,7-8H2,1-2H3,(H,21,24)(H,22,23).
What are the key properties of N-(cyanomethyl)-2-[3-(4,5-dichloro-1H-imidazol-2-yl)phenyl]-4-methylpentanamide?
N-(cyanomethyl)-2-[3-(4,5-dichloro-1H-imidazol-2-yl)phenyl]-4-methylpentanamide has a molecular weight of 365.26 g/mol, XLogP of 4.15, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-2-[3-(4,5-dichloro-1H-imidazol-2-yl)phenyl]-4-methylpentanamide is sourced from PubChem (CID 18628746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).