C24H31N5O — CID 71124643
(2R)-N-(aminomethyl)-2-[3-[4-[(1H-imidazol-2-ylmethylamino)methyl]phenyl]phenyl]-4-methylpentanamide (PubChem CID 71124643) has the molecular formula C24H31N5O and a molecular weight of 405.55 g/mol. Its IUPAC name is (2R)-N-(aminomethyl)-2-[3-[4-[(1H-imidazol-2-ylmethylamino)methyl]phenyl]phenyl]-4-methylpentanamide.
| Compound Name | (2R)-N-(aminomethyl)-2-[3-[4-[(1H-imidazol-2-ylmethylamino)methyl]phenyl]phenyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 71124643 |
| Molecular Formula | C24H31N5O |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | (2R)-N-(aminomethyl)-2-[3-[4-[(1H-imidazol-2-ylmethylamino)methyl]phenyl]phenyl]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](C(=O)NCN)c1cccc(-c2ccc(CNCc3ncc[nH]3)cc2)c1 |
| InChI | InChI=1S/C24H31N5O/c1-17(2)12-22(24(30)29-16-25)21-5-3-4-20(13-21)19-8-6-18(7-9-19)14-26-15-23-27-10-11-28-23/h3-11,13,17,22,26H,12,14-16,25H2,1-2H3,(H,27,28)(H,29,30)/t22-/m1/s1 |
| InChIKey | HIMBFSOXJHUTDT-JOCHJYFZSA-N |
| XLogP | 3.53 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|