C8H12ClN3O — CID 64532215
3-chloro-N-(1H-imidazol-2-ylmethyl)-2-methylpropanamide (PubChem CID 64532215) has the molecular formula C8H12ClN3O and a molecular weight of 201.66 g/mol. Its IUPAC name is 3-chloro-N-(1H-imidazol-2-ylmethyl)-2-methylpropanamide.
| Compound Name | 3-chloro-N-(1H-imidazol-2-ylmethyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 64532215 |
| Molecular Formula | C8H12ClN3O |
| Molecular Weight | 201.66 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 3-chloro-N-(1H-imidazol-2-ylmethyl)-2-methylpropanamide |
| SMILES | CC(CCl)C(=O)NCc1ncc[nH]1 |
| InChI | InChI=1S/C8H12ClN3O/c1-6(4-9)8(13)12-5-7-10-2-3-11-7/h2-3,6H,4-5H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | PBBDHLWTOZRERS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.66 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|