4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid

C10H15N3O3 — CID 103498569

IUPAC4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid
SMILESCC(C(=O)O)C(C)C(=O)NCc1ncc[nH]1
InChIInChI=1S/C10H15N3O3/c1-6(7(2)10(15)16)9(14)13-5-8-11-3-4-12-8/h3-4,6-7H,5H2,1-2H3,(H,11,12)(H,13,14)(H,15,16)
InChIKeyHWSDEIIKIWYZOI-UHFFFAOYSA-N
MW225.25 g/mol
LogP0.38
Rot. Bonds5

About 4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid

4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 103498569) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid
PubChem CID103498569
Molecular FormulaC10H15N3O3
Molecular Weight225.25 g/mol
Exact Mass225.11
IUPAC Name4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid
SMILESCC(C(=O)O)C(C)C(=O)NCc1ncc[nH]1
InChIInChI=1S/C10H15N3O3/c1-6(7(2)10(15)16)9(14)13-5-8-11-3-4-12-8/h3-4,6-7H,5H2,1-2H3,(H,11,12)(H,13,14)(H,15,16)
InChIKeyHWSDEIIKIWYZOI-UHFFFAOYSA-N
XLogP0.38
TPSA95.08 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.25
LogP ≤ 50.38
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid (CID 103498569) is 4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid is CC(C(=O)O)C(C)C(=O)NCc1ncc[nH]1.
What is the InChIKey of 4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid?
The InChIKey is HWSDEIIKIWYZOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3/c1-6(7(2)10(15)16)9(14)13-5-8-11-3-4-12-8/h3-4,6-7H,5H2,1-2H3,(H,11,12)(H,13,14)(H,15,16).
What are the key properties of 4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid?
4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid has a molecular weight of 225.25 g/mol, XLogP of 0.38, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 103498569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).