C10H15N3O3 — CID 103498569
4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 103498569) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 103498569 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 4-(1H-imidazol-2-ylmethylamino)-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | CC(C(=O)O)C(C)C(=O)NCc1ncc[nH]1 |
| InChI | InChI=1S/C10H15N3O3/c1-6(7(2)10(15)16)9(14)13-5-8-11-3-4-12-8/h3-4,6-7H,5H2,1-2H3,(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | HWSDEIIKIWYZOI-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |