C14H23N3O — CID 43675023
N,N,4-trimethyl-2-(pyridin-2-ylmethylamino)pentanamide (PubChem CID 43675023) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is N,N,4-trimethyl-2-(pyridin-2-ylmethylamino)pentanamide.
| Compound Name | N,N,4-trimethyl-2-(pyridin-2-ylmethylamino)pentanamide |
|---|---|
| PubChem CID | 43675023 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N,N,4-trimethyl-2-(pyridin-2-ylmethylamino)pentanamide |
| SMILES | CC(C)CC(NCc1ccccn1)C(=O)N(C)C |
| InChI | InChI=1S/C14H23N3O/c1-11(2)9-13(14(18)17(3)4)16-10-12-7-5-6-8-15-12/h5-8,11,13,16H,9-10H2,1-4H3 |
| InChIKey | MBFFSOIUKSTCRG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |