C15H11N3O4S — CID 98130250
(2R)-3-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]-2-cyano-N-methyl-3-oxopropanamide (PubChem CID 98130250) has the molecular formula C15H11N3O4S and a molecular weight of 329.34 g/mol. Its IUPAC name is (2R)-3-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]-2-cyano-N-methyl-3-oxopropanamide.
| Compound Name | (2R)-3-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]-2-cyano-N-methyl-3-oxopropanamide |
|---|---|
| PubChem CID | 98130250 |
| Molecular Formula | C15H11N3O4S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | (2R)-3-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]-2-cyano-N-methyl-3-oxopropanamide |
| SMILES | CNC(=O)[C@H](C#N)C(=O)c1csc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C15H11N3O4S/c1-17-14(20)9(5-16)13(19)10-6-23-15(18-10)8-2-3-11-12(4-8)22-7-21-11/h2-4,6,9H,7H2,1H3,(H,17,20)/t9-/m1/s1 |
| InChIKey | DFNPLIWRGQFQNL-SECBINFHSA-N |
| XLogP | 1.61 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|