C17H10FNO4S — CID 9044131
1,3-benzodioxol-5-yl 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate (PubChem CID 9044131) has the molecular formula C17H10FNO4S and a molecular weight of 343.34 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 9044131 |
| Molecular Formula | C17H10FNO4S |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 1,3-benzodioxol-5-yl 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate |
| SMILES | O=C(Oc1ccc2c(c1)OCO2)c1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H10FNO4S/c18-11-3-1-10(2-4-11)16-19-13(8-24-16)17(20)23-12-5-6-14-15(7-12)22-9-21-14/h1-8H,9H2 |
| InChIKey | RPVOJKDZQCAIRD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|