C19H16N2O4S — CID 99702126
2-(1,3-benzodioxol-5-yl)-N-methyl-N-phenylmethoxy-1,3-thiazole-4-carboxamide (PubChem CID 99702126) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-methyl-N-phenylmethoxy-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-methyl-N-phenylmethoxy-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 99702126 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-methyl-N-phenylmethoxy-1,3-thiazole-4-carboxamide |
| SMILES | CN(OCc1ccccc1)C(=O)c1csc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C19H16N2O4S/c1-21(25-10-13-5-3-2-4-6-13)19(22)15-11-26-18(20-15)14-7-8-16-17(9-14)24-12-23-16/h2-9,11H,10,12H2,1H3 |
| InChIKey | NVSVJILYLYBJJJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|