C21H29N7O — CID 22235768
N-(cyanomethyl)-4-methyl-2-[[4-(4-piperazin-1-ylphenyl)-1H-pyrazol-5-yl]amino]pentanamide (PubChem CID 22235768) has the molecular formula C21H29N7O and a molecular weight of 395.51 g/mol. Its IUPAC name is N-(cyanomethyl)-4-methyl-2-[[4-(4-piperazin-1-ylphenyl)-1H-pyrazol-5-yl]amino]pentanamide.
| Compound Name | N-(cyanomethyl)-4-methyl-2-[[4-(4-piperazin-1-ylphenyl)-1H-pyrazol-5-yl]amino]pentanamide |
|---|---|
| PubChem CID | 22235768 |
| Molecular Formula | C21H29N7O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | N-(cyanomethyl)-4-methyl-2-[[4-(4-piperazin-1-ylphenyl)-1H-pyrazol-5-yl]amino]pentanamide |
| SMILES | CC(C)CC(Nc1[nH]ncc1-c1ccc(N2CCNCC2)cc1)C(=O)NCC#N |
| InChI | InChI=1S/C21H29N7O/c1-15(2)13-19(21(29)24-8-7-22)26-20-18(14-25-27-20)16-3-5-17(6-4-16)28-11-9-23-10-12-28/h3-6,14-15,19,23H,8-13H2,1-2H3,(H,24,29)(H2,25,26,27) |
| InChIKey | KMLLEFVJPYJUIJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|