C25H30N4O — CID 22972551
N-(cyanomethyl)-3-(1-methylcyclopropyl)-2-[3-(4-piperazin-1-ylphenyl)phenyl]propanamide (PubChem CID 22972551) has the molecular formula C25H30N4O and a molecular weight of 402.54 g/mol. Its IUPAC name is N-(cyanomethyl)-3-(1-methylcyclopropyl)-2-[3-(4-piperazin-1-ylphenyl)phenyl]propanamide.
| Compound Name | N-(cyanomethyl)-3-(1-methylcyclopropyl)-2-[3-(4-piperazin-1-ylphenyl)phenyl]propanamide |
|---|---|
| PubChem CID | 22972551 |
| Molecular Formula | C25H30N4O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | N-(cyanomethyl)-3-(1-methylcyclopropyl)-2-[3-(4-piperazin-1-ylphenyl)phenyl]propanamide |
| SMILES | CC1(CC(C(=O)NCC#N)c2cccc(-c3ccc(N4CCNCC4)cc3)c2)CC1 |
| InChI | InChI=1S/C25H30N4O/c1-25(9-10-25)18-23(24(30)28-12-11-26)21-4-2-3-20(17-21)19-5-7-22(8-6-19)29-15-13-27-14-16-29/h2-8,17,23,27H,9-10,12-16,18H2,1H3,(H,28,30) |
| InChIKey | JGWMZLMOSAOKMA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|