C22H28N2O2S — CID 70093201
4-methyl-2-[4-(4-piperazin-1-ylphenyl)phenyl]sulfanylpentanoic acid (PubChem CID 70093201) has the molecular formula C22H28N2O2S and a molecular weight of 384.55 g/mol. Its IUPAC name is 4-methyl-2-[4-(4-piperazin-1-ylphenyl)phenyl]sulfanylpentanoic acid.
| Compound Name | 4-methyl-2-[4-(4-piperazin-1-ylphenyl)phenyl]sulfanylpentanoic acid |
|---|---|
| PubChem CID | 70093201 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 4-methyl-2-[4-(4-piperazin-1-ylphenyl)phenyl]sulfanylpentanoic acid |
| SMILES | CC(C)CC(Sc1ccc(-c2ccc(N3CCNCC3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C22H28N2O2S/c1-16(2)15-21(22(25)26)27-20-9-5-18(6-10-20)17-3-7-19(8-4-17)24-13-11-23-12-14-24/h3-10,16,21,23H,11-15H2,1-2H3,(H,25,26) |
| InChIKey | GIMXDGRHTYRIFQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |