2-hydroxy-3-(4-piperazin-1-ylphenyl)propanoic acid

C26H36N4O6 — CID 67735891

IUPAC2-hydroxy-3-(4-piperazin-1-ylphenyl)propanoic acid
SMILESO=C(O)C(O)Cc1ccc(N2CCNCC2)cc1.O=C(O)C(O)Cc1ccc(N2CCNCC2)cc1
InChIInChI=1S/2C13H18N2O3/c2*16-12(13(17)18)9-10-1-3-11(4-2-10)15-7-5-14-6-8-15/h2*1-4,12,14,16H,5-9H2,(H,17,18)
InChIKeyMWOGCICHAGOCDM-UHFFFAOYSA-N
MW500.60 g/mol
LogP0.17
Rot. Bonds8

About 2-hydroxy-3-(4-piperazin-1-ylphenyl)propanoic acid

2-hydroxy-3-(4-piperazin-1-ylphenyl)propanoic acid (PubChem CID 67735891) has the molecular formula C26H36N4O6 and a molecular weight of 500.60 g/mol. Its IUPAC name is 2-hydroxy-3-(4-piperazin-1-ylphenyl)propanoic acid.

Molecular Properties

Compound Name2-hydroxy-3-(4-piperazin-1-ylphenyl)propanoic acid
PubChem CID67735891
Molecular FormulaC26H36N4O6
Molecular Weight500.60 g/mol
Exact Mass500.26
IUPAC Name2-hydroxy-3-(4-piperazin-1-ylphenyl)propanoic acid
SMILESO=C(O)C(O)Cc1ccc(N2CCNCC2)cc1.O=C(O)C(O)Cc1ccc(N2CCNCC2)cc1
InChIInChI=1S/2C13H18N2O3/c2*16-12(13(17)18)9-10-1-3-11(4-2-10)15-7-5-14-6-8-15/h2*1-4,12,14,16H,5-9H2,(H,17,18)
InChIKeyMWOGCICHAGOCDM-UHFFFAOYSA-N
XLogP0.17
TPSA145.60 Ų
H-Bond Donors6
H-Bond Acceptors8
Rotatable Bonds8
Heavy Atoms36
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500500.60
LogP ≤ 50.17
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}

Analyze 2-hydroxy-3-(4-piperazin-1-ylphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-3-(4-piperazin-1-ylphenyl)propanoic acid?
The IUPAC name of 2-hydroxy-3-(4-piperazin-1-ylphenyl)propanoic acid (CID 67735891) is 2-hydroxy-3-(4-piperazin-1-ylphenyl)propanoic acid.
What is the SMILES notation for 2-hydroxy-3-(4-piperazin-1-ylphenyl)propanoic acid?
The canonical SMILES for 2-hydroxy-3-(4-piperazin-1-ylphenyl)propanoic acid is O=C(O)C(O)Cc1ccc(N2CCNCC2)cc1.O=C(O)C(O)Cc1ccc(N2CCNCC2)cc1.
What is the InChIKey of 2-hydroxy-3-(4-piperazin-1-ylphenyl)propanoic acid?
The InChIKey is MWOGCICHAGOCDM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H18N2O3/c2*16-12(13(17)18)9-10-1-3-11(4-2-10)15-7-5-14-6-8-15/h2*1-4,12,14,16H,5-9H2,(H,17,18).
What are the key properties of 2-hydroxy-3-(4-piperazin-1-ylphenyl)propanoic acid?
2-hydroxy-3-(4-piperazin-1-ylphenyl)propanoic acid has a molecular weight of 500.60 g/mol, XLogP of 0.17, 8 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-(4-piperazin-1-ylphenyl)propanoic acid is sourced from PubChem (CID 67735891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).