C15H22N2O5 — CID 18545024
butanedioic acid;1-(4-methoxyphenyl)piperazine (PubChem CID 18545024) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is butanedioic acid;1-(4-methoxyphenyl)piperazine.
| Compound Name | butanedioic acid;1-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 18545024 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | butanedioic acid;1-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCNCC2)cc1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C11H16N2O.C4H6O4/c1-14-11-4-2-10(3-5-11)13-8-6-12-7-9-13;5-3(6)1-2-4(7)8/h2-5,12H,6-9H2,1H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | SBVNXSPDVWOQBS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|