About 1-(4-methoxyphenyl)piperazine;1-piperazin-1-ylethanone
1-(4-methoxyphenyl)piperazine;1-piperazin-1-ylethanone (PubChem CID 173297247) has the molecular formula C17H28N4O2
and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)piperazine;1-piperazin-1-ylethanone.
Molecular Properties
| Compound Name | 1-(4-methoxyphenyl)piperazine;1-piperazin-1-ylethanone |
| PubChem CID | 173297247 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 1-(4-methoxyphenyl)piperazine;1-piperazin-1-ylethanone |
| SMILES | CC(=O)N1CCNCC1.COc1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C11H16N2O.C6H12N2O/c1-14-11-4-2-10(3-5-11)13-8-6-12-7-9-13;1-6(9)8-4-2-7-3-5-8/h2-5,12H,6-9H2,1H3;7H,2-5H2,1H3 |
| InChIKey | NIJBRCRVXQGDKZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methoxyphenyl)piperazine;1-piperazin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxyphenyl)piperazine;1-piperazin-1-ylethanone?
The IUPAC name of 1-(4-methoxyphenyl)piperazine;1-piperazin-1-ylethanone (CID 173297247) is 1-(4-methoxyphenyl)piperazine;1-piperazin-1-ylethanone.
What is the SMILES notation for 1-(4-methoxyphenyl)piperazine;1-piperazin-1-ylethanone?
The canonical SMILES for 1-(4-methoxyphenyl)piperazine;1-piperazin-1-ylethanone is CC(=O)N1CCNCC1.COc1ccc(N2CCNCC2)cc1.
What is the InChIKey of 1-(4-methoxyphenyl)piperazine;1-piperazin-1-ylethanone?
The InChIKey is NIJBRCRVXQGDKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O.C6H12N2O/c1-14-11-4-2-10(3-5-11)13-8-6-12-7-9-13;1-6(9)8-4-2-7-3-5-8/h2-5,12H,6-9H2,1H3;7H,2-5H2,1H3.
What are the key properties of 1-(4-methoxyphenyl)piperazine;1-piperazin-1-ylethanone?
1-(4-methoxyphenyl)piperazine;1-piperazin-1-ylethanone has a molecular weight of 320.44 g/mol, XLogP of 0.54, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxyphenyl)piperazine;1-piperazin-1-ylethanone is sourced from PubChem (CID 173297247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).