C25H31NO2WY-2 — CID 58176182
(3S)-5-methyl-3-[phenyl-(4-piperidin-1-id-4-ylphenyl)methoxy]hexan-2-one;tungsten;yttrium (PubChem CID 58176182) has the molecular formula C25H31NO2WY-2 and a molecular weight of 650.27 g/mol. Its IUPAC name is (3S)-5-methyl-3-[phenyl-(4-piperidin-1-id-4-ylphenyl)methoxy]hexan-2-one;tungsten;yttrium.
| Compound Name | (3S)-5-methyl-3-[phenyl-(4-piperidin-1-id-4-ylphenyl)methoxy]hexan-2-one;tungsten;yttrium |
|---|---|
| PubChem CID | 58176182 |
| Molecular Formula | C25H31NO2WY-2 |
| Molecular Weight | 650.27 g/mol |
| Exact Mass | 650.09 |
| IUPAC Name | (3S)-5-methyl-3-[phenyl-(4-piperidin-1-id-4-ylphenyl)methoxy]hexan-2-one;tungsten;yttrium |
| SMILES | [CH2-]C(=O)[C@H](CC(C)C)OC(c1ccccc1)c1ccc(C2CC[N-]CC2)cc1.[W].[Y] |
| InChI | InChI=1S/C25H31NO2.W.Y/c1-18(2)17-24(19(3)27)28-25(22-7-5-4-6-8-22)23-11-9-20(10-12-23)21-13-15-26-16-14-21;;/h4-12,18,21,24-25H,3,13-17H2,1-2H3;;/q-2;;/t24-,25?;;/m0../s1 |
| InChIKey | UHFQCXOHJAIKKI-ALSOZGBCSA-N |
| XLogP | 5.86 |
| TPSA | 40.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.27 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|