C18H20O2 — CID 103459446
1-(4-cyclobutylphenyl)-2-phenylethane-1,2-diol (PubChem CID 103459446) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-(4-cyclobutylphenyl)-2-phenylethane-1,2-diol.
| Compound Name | 1-(4-cyclobutylphenyl)-2-phenylethane-1,2-diol |
|---|---|
| PubChem CID | 103459446 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1-(4-cyclobutylphenyl)-2-phenylethane-1,2-diol |
| SMILES | OC(c1ccccc1)C(O)c1ccc(C2CCC2)cc1 |
| InChI | InChI=1S/C18H20O2/c19-17(15-5-2-1-3-6-15)18(20)16-11-9-14(10-12-16)13-7-4-8-13/h1-3,5-6,9-13,17-20H,4,7-8H2 |
| InChIKey | ZHQMVEGESABDHB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |