C20H23N — CID 116506095
(4-cyclobutylphenyl)-(1-phenylcyclopropyl)methanamine (PubChem CID 116506095) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is (4-cyclobutylphenyl)-(1-phenylcyclopropyl)methanamine.
| Compound Name | (4-cyclobutylphenyl)-(1-phenylcyclopropyl)methanamine |
|---|---|
| PubChem CID | 116506095 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (4-cyclobutylphenyl)-(1-phenylcyclopropyl)methanamine |
| SMILES | NC(c1ccc(C2CCC2)cc1)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H23N/c21-19(20(13-14-20)18-7-2-1-3-8-18)17-11-9-16(10-12-17)15-5-4-6-15/h1-3,7-12,15,19H,4-6,13-14,21H2 |
| InChIKey | KPWDPVYJWZUXCP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |