About dichloroplatinum(2+);bis(4-phenylpiperidin-1-ide)
dichloroplatinum(2+);bis(4-phenylpiperidin-1-ide) (PubChem CID 54598558) has the molecular formula C22H28Cl2N2Pt
and a molecular weight of 586.46 g/mol. Its IUPAC name is dichloroplatinum(2+);bis(4-phenylpiperidin-1-ide).
Molecular Properties
| Compound Name | dichloroplatinum(2+);bis(4-phenylpiperidin-1-ide) |
| PubChem CID | 54598558 |
| Molecular Formula | C22H28Cl2N2Pt |
| Molecular Weight | 586.46 g/mol |
| Exact Mass | 585.13 |
| IUPAC Name | dichloroplatinum(2+);bis(4-phenylpiperidin-1-ide) |
| SMILES | Cl[Pt+2]Cl.c1ccc(C2CC[N-]CC2)cc1.c1ccc(C2CC[N-]CC2)cc1 |
| InChI | InChI=1S/2C11H14N.2ClH.Pt/c2*1-2-4-10(5-3-1)11-6-8-12-9-7-11;;;/h2*1-5,11H,6-9H2;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | GEJPDXCRSFHWFZ-UHFFFAOYSA-L |
| XLogP | 7.25 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.46 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dichloroplatinum(2+);bis(4-phenylpiperidin-1-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum(2+);bis(4-phenylpiperidin-1-ide)?
The IUPAC name of dichloroplatinum(2+);bis(4-phenylpiperidin-1-ide) (CID 54598558) is dichloroplatinum(2+);bis(4-phenylpiperidin-1-ide).
What is the SMILES notation for dichloroplatinum(2+);bis(4-phenylpiperidin-1-ide)?
The canonical SMILES for dichloroplatinum(2+);bis(4-phenylpiperidin-1-ide) is Cl[Pt+2]Cl.c1ccc(C2CC[N-]CC2)cc1.c1ccc(C2CC[N-]CC2)cc1.
What is the InChIKey of dichloroplatinum(2+);bis(4-phenylpiperidin-1-ide)?
The InChIKey is GEJPDXCRSFHWFZ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C11H14N.2ClH.Pt/c2*1-2-4-10(5-3-1)11-6-8-12-9-7-11;;;/h2*1-5,11H,6-9H2;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of dichloroplatinum(2+);bis(4-phenylpiperidin-1-ide)?
dichloroplatinum(2+);bis(4-phenylpiperidin-1-ide) has a molecular weight of 586.46 g/mol, XLogP of 7.25, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum(2+);bis(4-phenylpiperidin-1-ide) is sourced from PubChem (CID 54598558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).