About 3-phenylpiperidin-1-ide;rhenium
3-phenylpiperidin-1-ide;rhenium (PubChem CID 166488645) has the molecular formula C11H14NRe-
and a molecular weight of 346.45 g/mol. Its IUPAC name is 3-phenylpiperidin-1-ide;rhenium.
Molecular Properties
| Compound Name | 3-phenylpiperidin-1-ide;rhenium |
| PubChem CID | 166488645 |
| Molecular Formula | C11H14NRe- |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 3-phenylpiperidin-1-ide;rhenium |
| SMILES | [Re].c1ccc(C2CCC[N-]C2)cc1 |
| InChI | InChI=1S/C11H14N.Re/c1-2-5-10(6-3-1)11-7-4-8-12-9-11;/h1-3,5-6,11H,4,7-9H2;/q-1; |
| InChIKey | XAMAAGUPBHFCKP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-phenylpiperidin-1-ide;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpiperidin-1-ide;rhenium?
The IUPAC name of 3-phenylpiperidin-1-ide;rhenium (CID 166488645) is 3-phenylpiperidin-1-ide;rhenium.
What is the SMILES notation for 3-phenylpiperidin-1-ide;rhenium?
The canonical SMILES for 3-phenylpiperidin-1-ide;rhenium is [Re].c1ccc(C2CCC[N-]C2)cc1.
What is the InChIKey of 3-phenylpiperidin-1-ide;rhenium?
The InChIKey is XAMAAGUPBHFCKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N.Re/c1-2-5-10(6-3-1)11-7-4-8-12-9-11;/h1-3,5-6,11H,4,7-9H2;/q-1;.
What are the key properties of 3-phenylpiperidin-1-ide;rhenium?
3-phenylpiperidin-1-ide;rhenium has a molecular weight of 346.45 g/mol, XLogP of 2.94, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpiperidin-1-ide;rhenium is sourced from PubChem (CID 166488645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).