C13H18O — CID 95376716
trans-(1R,3R)-3-phenylcycloheptan-1-ol (PubChem CID 95376716) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is trans-(1R,3R)-3-phenylcycloheptan-1-ol.
| Compound Name | trans-(1R,3R)-3-phenylcycloheptan-1-ol |
|---|---|
| PubChem CID | 95376716 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | trans-(1R,3R)-3-phenylcycloheptan-1-ol |
| SMILES | O[C@@H]1CCCC[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C13H18O/c14-13-9-5-4-8-12(10-13)11-6-2-1-3-7-11/h1-3,6-7,12-14H,4-5,8-10H2/t12-,13-/m1/s1 |
| InChIKey | PWEFIUJVBSBVHN-CHWSQXEVSA-N |
| XLogP | 3.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |