C16H22O — CID 114194593
3-(2,3-dihydro-1H-inden-5-yl)cycloheptan-1-ol (PubChem CID 114194593) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-yl)cycloheptan-1-ol.
| Compound Name | 3-(2,3-dihydro-1H-inden-5-yl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 114194593 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-yl)cycloheptan-1-ol |
| SMILES | OC1CCCCC(c2ccc3c(c2)CCC3)C1 |
| InChI | InChI=1S/C16H22O/c17-16-7-2-1-4-14(11-16)15-9-8-12-5-3-6-13(12)10-15/h8-10,14,16-17H,1-7,11H2 |
| InChIKey | LQVIVWSTPBMQMC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |