C15H18O — CID 125481421
6-cyclohexyl-2,3-dihydroinden-1-one (PubChem CID 125481421) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is 6-cyclohexyl-2,3-dihydroinden-1-one.
| Compound Name | 6-cyclohexyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 125481421 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 6-cyclohexyl-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2ccc(C3CCCCC3)cc21 |
| InChI | InChI=1S/C15H18O/c16-15-9-8-12-6-7-13(10-14(12)15)11-4-2-1-3-5-11/h6-7,10-11H,1-5,8-9H2 |
| InChIKey | BCMPNQJPGBFHSM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |