About 6-cyclohexyl-1,2,3,4-tetrahydroanthracene
6-cyclohexyl-1,2,3,4-tetrahydroanthracene (PubChem CID 141269352) has the molecular formula C20H24
and a molecular weight of 264.41 g/mol. Its IUPAC name is 6-cyclohexyl-1,2,3,4-tetrahydroanthracene.
Molecular Properties
| Compound Name | 6-cyclohexyl-1,2,3,4-tetrahydroanthracene |
| PubChem CID | 141269352 |
| Molecular Formula | C20H24 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 6-cyclohexyl-1,2,3,4-tetrahydroanthracene |
| SMILES | c1cc2cc3c(cc2cc1C1CCCCC1)CCCC3 |
| InChI | InChI=1S/C20H24/c1-2-6-15(7-3-1)18-10-11-19-12-16-8-4-5-9-17(16)13-20(19)14-18/h10-15H,1-9H2 |
| InChIKey | QAZIOBRUFXXLMD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-cyclohexyl-1,2,3,4-tetrahydroanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohexyl-1,2,3,4-tetrahydroanthracene?
The IUPAC name of 6-cyclohexyl-1,2,3,4-tetrahydroanthracene (CID 141269352) is 6-cyclohexyl-1,2,3,4-tetrahydroanthracene.
What is the SMILES notation for 6-cyclohexyl-1,2,3,4-tetrahydroanthracene?
The canonical SMILES for 6-cyclohexyl-1,2,3,4-tetrahydroanthracene is c1cc2cc3c(cc2cc1C1CCCCC1)CCCC3.
What is the InChIKey of 6-cyclohexyl-1,2,3,4-tetrahydroanthracene?
The InChIKey is QAZIOBRUFXXLMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24/c1-2-6-15(7-3-1)18-10-11-19-12-16-8-4-5-9-17(16)13-20(19)14-18/h10-15H,1-9H2.
What are the key properties of 6-cyclohexyl-1,2,3,4-tetrahydroanthracene?
6-cyclohexyl-1,2,3,4-tetrahydroanthracene has a molecular weight of 264.41 g/mol, XLogP of 5.77, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohexyl-1,2,3,4-tetrahydroanthracene is sourced from PubChem (CID 141269352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).