About 6-cyclohexylphthalazine
6-cyclohexylphthalazine (PubChem CID 21134758) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is 6-cyclohexylphthalazine.
Molecular Properties
| Compound Name | 6-cyclohexylphthalazine |
| PubChem CID | 21134758 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 6-cyclohexylphthalazine |
| SMILES | c1cc2cnncc2cc1C1CCCCC1 |
| InChI | InChI=1S/C14H16N2/c1-2-4-11(5-3-1)12-6-7-13-9-15-16-10-14(13)8-12/h6-11H,1-5H2 |
| InChIKey | FCZDBUCJKXFMHY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-cyclohexylphthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohexylphthalazine?
The IUPAC name of 6-cyclohexylphthalazine (CID 21134758) is 6-cyclohexylphthalazine.
What is the SMILES notation for 6-cyclohexylphthalazine?
The canonical SMILES for 6-cyclohexylphthalazine is c1cc2cnncc2cc1C1CCCCC1.
What is the InChIKey of 6-cyclohexylphthalazine?
The InChIKey is FCZDBUCJKXFMHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2/c1-2-4-11(5-3-1)12-6-7-13-9-15-16-10-14(13)8-12/h6-11H,1-5H2.
What are the key properties of 6-cyclohexylphthalazine?
6-cyclohexylphthalazine has a molecular weight of 212.30 g/mol, XLogP of 3.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohexylphthalazine is sourced from PubChem (CID 21134758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).