About 4-cyclohexylbenzene-1,2-dithiol
4-cyclohexylbenzene-1,2-dithiol (PubChem CID 22497894) has the molecular formula C12H16S2
and a molecular weight of 224.39 g/mol. Its IUPAC name is 4-cyclohexylbenzene-1,2-dithiol.
Molecular Properties
| Compound Name | 4-cyclohexylbenzene-1,2-dithiol |
| PubChem CID | 22497894 |
| Molecular Formula | C12H16S2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 4-cyclohexylbenzene-1,2-dithiol |
| SMILES | Sc1ccc(C2CCCCC2)cc1S |
| InChI | InChI=1S/C12H16S2/c13-11-7-6-10(8-12(11)14)9-4-2-1-3-5-9/h6-9,13-14H,1-5H2 |
| InChIKey | KVDFPKYVACBZJL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexylbenzene-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylbenzene-1,2-dithiol?
The IUPAC name of 4-cyclohexylbenzene-1,2-dithiol (CID 22497894) is 4-cyclohexylbenzene-1,2-dithiol.
What is the SMILES notation for 4-cyclohexylbenzene-1,2-dithiol?
The canonical SMILES for 4-cyclohexylbenzene-1,2-dithiol is Sc1ccc(C2CCCCC2)cc1S.
What is the InChIKey of 4-cyclohexylbenzene-1,2-dithiol?
The InChIKey is KVDFPKYVACBZJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16S2/c13-11-7-6-10(8-12(11)14)9-4-2-1-3-5-9/h6-9,13-14H,1-5H2.
What are the key properties of 4-cyclohexylbenzene-1,2-dithiol?
4-cyclohexylbenzene-1,2-dithiol has a molecular weight of 224.39 g/mol, XLogP of 4.31, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylbenzene-1,2-dithiol is sourced from PubChem (CID 22497894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).