C17H20O2 — CID 18472389
7-cyclohexyl-3,4-dihydronaphthalene-2-carboxylic acid (PubChem CID 18472389) has the molecular formula C17H20O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 7-cyclohexyl-3,4-dihydronaphthalene-2-carboxylic acid.
| Compound Name | 7-cyclohexyl-3,4-dihydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 18472389 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 7-cyclohexyl-3,4-dihydronaphthalene-2-carboxylic acid |
| SMILES | O=C(O)C1=Cc2cc(C3CCCCC3)ccc2CC1 |
| InChI | InChI=1S/C17H20O2/c18-17(19)15-9-7-13-6-8-14(10-16(13)11-15)12-4-2-1-3-5-12/h6,8,10-12H,1-5,7,9H2,(H,18,19) |
| InChIKey | WUXVSQOGSLBPLT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |