C16H21NO — CID 87840438
(NE)-N-(7-cyclohexyl-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine (PubChem CID 87840438) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is (NE)-N-(7-cyclohexyl-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(7-cyclohexyl-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 87840438 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (NE)-N-(7-cyclohexyl-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine |
| SMILES | O/N=C1\CCCc2ccc(C3CCCCC3)cc21 |
| InChI | InChI=1S/C16H21NO/c18-17-16-8-4-7-13-9-10-14(11-15(13)16)12-5-2-1-3-6-12/h9-12,18H,1-8H2/b17-16+ |
| InChIKey | DHXQERRRUNEGNH-WUKNDPDISA-N |
| XLogP | 4.25 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|