C13H18 — CID 134965435
[(1S,3R)-3-methylcyclohexyl]benzene (PubChem CID 134965435) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is [(1S,3R)-3-methylcyclohexyl]benzene.
| Compound Name | [(1S,3R)-3-methylcyclohexyl]benzene |
|---|---|
| PubChem CID | 134965435 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | [(1S,3R)-3-methylcyclohexyl]benzene |
| SMILES | C[C@@H]1CCC[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C13H18/c1-11-6-5-9-13(10-11)12-7-3-2-4-8-12/h2-4,7-8,11,13H,5-6,9-10H2,1H3/t11-,13+/m1/s1 |
| InChIKey | UXXPWMSRTKKHNF-YPMHNXCESA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |