C15H26N2 — CID 142330128
N,N-dimethyl-3-phenylcyclohexan-1-amine;methanamine (PubChem CID 142330128) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is N,N-dimethyl-3-phenylcyclohexan-1-amine;methanamine.
| Compound Name | N,N-dimethyl-3-phenylcyclohexan-1-amine;methanamine |
|---|---|
| PubChem CID | 142330128 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N,N-dimethyl-3-phenylcyclohexan-1-amine;methanamine |
| SMILES | CN.CN(C)C1CCCC(c2ccccc2)C1 |
| InChI | InChI=1S/C14H21N.CH5N/c1-15(2)14-10-6-9-13(11-14)12-7-4-3-5-8-12;1-2/h3-5,7-8,13-14H,6,9-11H2,1-2H3;2H2,1H3 |
| InChIKey | QVNXCCPDBLBPLU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |