C17H25NO — CID 139448865
N,N-dimethyl-3-[3-(oxetan-3-yl)phenyl]cyclohexan-1-amine (PubChem CID 139448865) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is N,N-dimethyl-3-[3-(oxetan-3-yl)phenyl]cyclohexan-1-amine.
| Compound Name | N,N-dimethyl-3-[3-(oxetan-3-yl)phenyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 139448865 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | N,N-dimethyl-3-[3-(oxetan-3-yl)phenyl]cyclohexan-1-amine |
| SMILES | CN(C)C1CCCC(c2cccc(C3COC3)c2)C1 |
| InChI | InChI=1S/C17H25NO/c1-18(2)17-8-4-7-15(10-17)13-5-3-6-14(9-13)16-11-19-12-16/h3,5-6,9,15-17H,4,7-8,10-12H2,1-2H3 |
| InChIKey | VDJUVRVBYHTAFK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |