C17H24F3N — CID 153367568
N,N-diethyl-3-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine (PubChem CID 153367568) has the molecular formula C17H24F3N and a molecular weight of 299.38 g/mol. Its IUPAC name is N,N-diethyl-3-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine.
| Compound Name | N,N-diethyl-3-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 153367568 |
| Molecular Formula | C17H24F3N |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | N,N-diethyl-3-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine |
| SMILES | CCN(CC)C1CCCC(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C17H24F3N/c1-3-21(4-2)16-10-6-8-14(12-16)13-7-5-9-15(11-13)17(18,19)20/h5,7,9,11,14,16H,3-4,6,8,10,12H2,1-2H3 |
| InChIKey | NTTIOLCLYSTQKI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |