About 1-(1,1-difluoroethyl)-3-[(1S)-3-propan-2-ylcyclohexyl]benzene
1-(1,1-difluoroethyl)-3-[(1S)-3-propan-2-ylcyclohexyl]benzene (PubChem CID 163547034) has the molecular formula C17H24F2
and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-(1,1-difluoroethyl)-3-[(1S)-3-propan-2-ylcyclohexyl]benzene.
Molecular Properties
| Compound Name | 1-(1,1-difluoroethyl)-3-[(1S)-3-propan-2-ylcyclohexyl]benzene |
| PubChem CID | 163547034 |
| Molecular Formula | C17H24F2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 1-(1,1-difluoroethyl)-3-[(1S)-3-propan-2-ylcyclohexyl]benzene |
| SMILES | CC(C)C1CCC[C@H](c2cccc(C(C)(F)F)c2)C1 |
| InChI | InChI=1S/C17H24F2/c1-12(2)13-6-4-7-14(10-13)15-8-5-9-16(11-15)17(3,18)19/h5,8-9,11-14H,4,6-7,10H2,1-3H3/t13?,14-/m0/s1 |
| InChIKey | FFXFIVRNLGISLX-KZUDCZAMSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(1,1-difluoroethyl)-3-[(1S)-3-propan-2-ylcyclohexyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-difluoroethyl)-3-[(1S)-3-propan-2-ylcyclohexyl]benzene?
The IUPAC name of 1-(1,1-difluoroethyl)-3-[(1S)-3-propan-2-ylcyclohexyl]benzene (CID 163547034) is 1-(1,1-difluoroethyl)-3-[(1S)-3-propan-2-ylcyclohexyl]benzene.
What is the SMILES notation for 1-(1,1-difluoroethyl)-3-[(1S)-3-propan-2-ylcyclohexyl]benzene?
The canonical SMILES for 1-(1,1-difluoroethyl)-3-[(1S)-3-propan-2-ylcyclohexyl]benzene is CC(C)C1CCC[C@H](c2cccc(C(C)(F)F)c2)C1.
What is the InChIKey of 1-(1,1-difluoroethyl)-3-[(1S)-3-propan-2-ylcyclohexyl]benzene?
The InChIKey is FFXFIVRNLGISLX-KZUDCZAMSA-N. The full InChI is InChI=1S/C17H24F2/c1-12(2)13-6-4-7-14(10-13)15-8-5-9-16(11-15)17(3,18)19/h5,8-9,11-14H,4,6-7,10H2,1-3H3/t13?,14-/m0/s1.
What are the key properties of 1-(1,1-difluoroethyl)-3-[(1S)-3-propan-2-ylcyclohexyl]benzene?
1-(1,1-difluoroethyl)-3-[(1S)-3-propan-2-ylcyclohexyl]benzene has a molecular weight of 266.38 g/mol, XLogP of 5.73, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-difluoroethyl)-3-[(1S)-3-propan-2-ylcyclohexyl]benzene is sourced from PubChem (CID 163547034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).