C16H25N — CID 162654109
N,N-dimethyl-2-[(1R,3S)-3-phenylcyclohexyl]ethanamine (PubChem CID 162654109) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is N,N-dimethyl-2-[(1R,3S)-3-phenylcyclohexyl]ethanamine.
| Compound Name | N,N-dimethyl-2-[(1R,3S)-3-phenylcyclohexyl]ethanamine |
|---|---|
| PubChem CID | 162654109 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | N,N-dimethyl-2-[(1R,3S)-3-phenylcyclohexyl]ethanamine |
| SMILES | CN(C)CC[C@@H]1CCC[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C16H25N/c1-17(2)12-11-14-7-6-10-16(13-14)15-8-4-3-5-9-15/h3-5,8-9,14,16H,6-7,10-13H2,1-2H3/t14-,16-/m0/s1 |
| InChIKey | ZYBYYRNPRPPBBV-HOCLYGCPSA-N |
| XLogP | 3.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |