About 6-phenylspiro[2.5]octane
6-phenylspiro[2.5]octane (PubChem CID 123640963) has the molecular formula C14H18
and a molecular weight of 186.30 g/mol. Its IUPAC name is 6-phenylspiro[2.5]octane.
Molecular Properties
| Compound Name | 6-phenylspiro[2.5]octane |
| PubChem CID | 123640963 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 6-phenylspiro[2.5]octane |
| SMILES | c1ccc(C2CCC3(CC2)CC3)cc1 |
| InChI | InChI=1S/C14H18/c1-2-4-12(5-3-1)13-6-8-14(9-7-13)10-11-14/h1-5,13H,6-11H2 |
| InChIKey | YSOBINUHZLSDDW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-phenylspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenylspiro[2.5]octane?
The IUPAC name of 6-phenylspiro[2.5]octane (CID 123640963) is 6-phenylspiro[2.5]octane.
What is the SMILES notation for 6-phenylspiro[2.5]octane?
The canonical SMILES for 6-phenylspiro[2.5]octane is c1ccc(C2CCC3(CC2)CC3)cc1.
What is the InChIKey of 6-phenylspiro[2.5]octane?
The InChIKey is YSOBINUHZLSDDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18/c1-2-4-12(5-3-1)13-6-8-14(9-7-13)10-11-14/h1-5,13H,6-11H2.
What are the key properties of 6-phenylspiro[2.5]octane?
6-phenylspiro[2.5]octane has a molecular weight of 186.30 g/mol, XLogP of 4.12, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylspiro[2.5]octane is sourced from PubChem (CID 123640963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).