About 4-phenylthiane
4-phenylthiane (PubChem CID 601191) has the molecular formula C11H14S
and a molecular weight of 178.30 g/mol. Its IUPAC name is 4-phenylthiane.
Molecular Properties
| Compound Name | 4-phenylthiane |
| PubChem CID | 601191 |
| Molecular Formula | C11H14S |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 4-phenylthiane |
| SMILES | c1ccc(C2CCSCC2)cc1 |
| InChI | InChI=1S/C11H14S/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h1-5,11H,6-9H2 |
| InChIKey | FJJXAEWYHQWEBS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-phenylthiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylthiane?
The IUPAC name of 4-phenylthiane (CID 601191) is 4-phenylthiane.
What is the SMILES notation for 4-phenylthiane?
The canonical SMILES for 4-phenylthiane is c1ccc(C2CCSCC2)cc1.
What is the InChIKey of 4-phenylthiane?
The InChIKey is FJJXAEWYHQWEBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14S/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h1-5,11H,6-9H2.
What are the key properties of 4-phenylthiane?
4-phenylthiane has a molecular weight of 178.30 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylthiane is sourced from PubChem (CID 601191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).