C20H23BrO5S — CID 69474622
(2S)-2-[(4-bromophenyl)-(4-methylsulfonylphenyl)methoxy]-4-methylpentanoic acid (PubChem CID 69474622) has the molecular formula C20H23BrO5S and a molecular weight of 455.37 g/mol. Its IUPAC name is (2S)-2-[(4-bromophenyl)-(4-methylsulfonylphenyl)methoxy]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(4-bromophenyl)-(4-methylsulfonylphenyl)methoxy]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 69474622 |
| Molecular Formula | C20H23BrO5S |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | (2S)-2-[(4-bromophenyl)-(4-methylsulfonylphenyl)methoxy]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](OC(c1ccc(Br)cc1)c1ccc(S(C)(=O)=O)cc1)C(=O)O |
| InChI | InChI=1S/C20H23BrO5S/c1-13(2)12-18(20(22)23)26-19(14-4-8-16(21)9-5-14)15-6-10-17(11-7-15)27(3,24)25/h4-11,13,18-19H,12H2,1-3H3,(H,22,23)/t18-,19?/m0/s1 |
| InChIKey | OACUDFRKRYOZGL-OYKVQYDMSA-N |
| XLogP | 4.46 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |