C17H20BrNO2S — CID 46551617
N-[(4-bromophenyl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)ethanamine (PubChem CID 46551617) has the molecular formula C17H20BrNO2S and a molecular weight of 382.32 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)ethanamine.
| Compound Name | N-[(4-bromophenyl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)ethanamine |
|---|---|
| PubChem CID | 46551617 |
| Molecular Formula | C17H20BrNO2S |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)ethanamine |
| SMILES | CC(c1ccc(S(C)(=O)=O)cc1)N(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H20BrNO2S/c1-13(15-6-10-17(11-7-15)22(3,20)21)19(2)12-14-4-8-16(18)9-5-14/h4-11,13H,12H2,1-3H3 |
| InChIKey | ZHEWWKNSLOYPTB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |