C16H19BrN2O2S — CID 46615150
4-[1-[(4-bromophenyl)methyl-methylamino]ethyl]benzenesulfonamide (PubChem CID 46615150) has the molecular formula C16H19BrN2O2S and a molecular weight of 383.31 g/mol. Its IUPAC name is 4-[1-[(4-bromophenyl)methyl-methylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[1-[(4-bromophenyl)methyl-methylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46615150 |
| Molecular Formula | C16H19BrN2O2S |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 4-[1-[(4-bromophenyl)methyl-methylamino]ethyl]benzenesulfonamide |
| SMILES | CC(c1ccc(S(N)(=O)=O)cc1)N(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H19BrN2O2S/c1-12(14-5-9-16(10-6-14)22(18,20)21)19(2)11-13-3-7-15(17)8-4-13/h3-10,12H,11H2,1-2H3,(H2,18,20,21) |
| InChIKey | FLMBZGFTQIJESX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |