C17H21FN2O2S — CID 124885486
4-[(1S)-1-[(5-fluoro-2-methylphenyl)methyl-methylamino]ethyl]benzenesulfonamide (PubChem CID 124885486) has the molecular formula C17H21FN2O2S and a molecular weight of 336.43 g/mol. Its IUPAC name is 4-[(1S)-1-[(5-fluoro-2-methylphenyl)methyl-methylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[(1S)-1-[(5-fluoro-2-methylphenyl)methyl-methylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 124885486 |
| Molecular Formula | C17H21FN2O2S |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 4-[(1S)-1-[(5-fluoro-2-methylphenyl)methyl-methylamino]ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(F)cc1CN(C)[C@@H](C)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H21FN2O2S/c1-12-4-7-16(18)10-15(12)11-20(3)13(2)14-5-8-17(9-6-14)23(19,21)22/h4-10,13H,11H2,1-3H3,(H2,19,21,22)/t13-/m0/s1 |
| InChIKey | SNWILUZRBZAYBL-ZDUSSCGKSA-N |
| XLogP | 2.97 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |