C18H20F3NO2S — CID 37302759
(1R)-N-methyl-1-(4-methylsulfonylphenyl)-N-[[2-(trifluoromethyl)phenyl]methyl]ethanamine (PubChem CID 37302759) has the molecular formula C18H20F3NO2S and a molecular weight of 371.42 g/mol. Its IUPAC name is (1R)-N-methyl-1-(4-methylsulfonylphenyl)-N-[[2-(trifluoromethyl)phenyl]methyl]ethanamine.
| Compound Name | (1R)-N-methyl-1-(4-methylsulfonylphenyl)-N-[[2-(trifluoromethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 37302759 |
| Molecular Formula | C18H20F3NO2S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | (1R)-N-methyl-1-(4-methylsulfonylphenyl)-N-[[2-(trifluoromethyl)phenyl]methyl]ethanamine |
| SMILES | C[C@H](c1ccc(S(C)(=O)=O)cc1)N(C)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H20F3NO2S/c1-13(14-8-10-16(11-9-14)25(3,23)24)22(2)12-15-6-4-5-7-17(15)18(19,20)21/h4-11,13H,12H2,1-3H3/t13-/m1/s1 |
| InChIKey | ZVYVVVFQOBBBAH-CYBMUJFWSA-N |
| XLogP | 4.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |