C30H36N2O2 — CID 142020821
1-methyl-4-phenylpiperidine;(2R)-2-phenyl-2-(3-phenylpyrrolidin-1-yl)acetic acid (PubChem CID 142020821) has the molecular formula C30H36N2O2 and a molecular weight of 456.63 g/mol. Its IUPAC name is 1-methyl-4-phenylpiperidine;(2R)-2-phenyl-2-(3-phenylpyrrolidin-1-yl)acetic acid.
| Compound Name | 1-methyl-4-phenylpiperidine;(2R)-2-phenyl-2-(3-phenylpyrrolidin-1-yl)acetic acid |
|---|---|
| PubChem CID | 142020821 |
| Molecular Formula | C30H36N2O2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 1-methyl-4-phenylpiperidine;(2R)-2-phenyl-2-(3-phenylpyrrolidin-1-yl)acetic acid |
| SMILES | CN1CCC(c2ccccc2)CC1.O=C(O)[C@@H](c1ccccc1)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C18H19NO2.C12H17N/c20-18(21)17(15-9-5-2-6-10-15)19-12-11-16(13-19)14-7-3-1-4-8-14;1-13-9-7-12(8-10-13)11-5-3-2-4-6-11/h1-10,16-17H,11-13H2,(H,20,21);2-6,12H,7-10H2,1H3/t16?,17-;/m1./s1 |
| InChIKey | YTNPPUMGNTUMMZ-KOUJAAPTSA-N |
| XLogP | 5.80 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |