C22H24BrClN2O2 — CID 10004626
(2S)-2-[(1R)-1-(4-bromophenyl)-2-(4-chlorophenyl)ethoxy]-N-(cyanomethyl)-4-methylpentanamide (PubChem CID 10004626) has the molecular formula C22H24BrClN2O2 and a molecular weight of 463.80 g/mol. Its IUPAC name is (2S)-2-[(1R)-1-(4-bromophenyl)-2-(4-chlorophenyl)ethoxy]-N-(cyanomethyl)-4-methylpentanamide.
| Compound Name | (2S)-2-[(1R)-1-(4-bromophenyl)-2-(4-chlorophenyl)ethoxy]-N-(cyanomethyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 10004626 |
| Molecular Formula | C22H24BrClN2O2 |
| Molecular Weight | 463.80 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | (2S)-2-[(1R)-1-(4-bromophenyl)-2-(4-chlorophenyl)ethoxy]-N-(cyanomethyl)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](O[C@H](Cc1ccc(Cl)cc1)c1ccc(Br)cc1)C(=O)NCC#N |
| InChI | InChI=1S/C22H24BrClN2O2/c1-15(2)13-21(22(27)26-12-11-25)28-20(17-5-7-18(23)8-6-17)14-16-3-9-19(24)10-4-16/h3-10,15,20-21H,12-14H2,1-2H3,(H,26,27)/t20-,21+/m1/s1 |
| InChIKey | MOYQZRRIMRAAJS-RTWAWAEBSA-N |
| XLogP | 5.46 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.80 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|