C29H43F3N4O3 — CID 143876369
4-methyl-N-[2-(4-morpholin-4-ylanilino)ethyl]-2-[(2,2,2-trifluoro-1-phenylethyl)amino]pentanamide;propan-1-ol (PubChem CID 143876369) has the molecular formula C29H43F3N4O3 and a molecular weight of 552.68 g/mol. Its IUPAC name is 4-methyl-N-[2-(4-morpholin-4-ylanilino)ethyl]-2-[(2,2,2-trifluoro-1-phenylethyl)amino]pentanamide;propan-1-ol.
| Compound Name | 4-methyl-N-[2-(4-morpholin-4-ylanilino)ethyl]-2-[(2,2,2-trifluoro-1-phenylethyl)amino]pentanamide;propan-1-ol |
|---|---|
| PubChem CID | 143876369 |
| Molecular Formula | C29H43F3N4O3 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | 4-methyl-N-[2-(4-morpholin-4-ylanilino)ethyl]-2-[(2,2,2-trifluoro-1-phenylethyl)amino]pentanamide;propan-1-ol |
| SMILES | CC(C)CC(NC(c1ccccc1)C(F)(F)F)C(=O)NCCNc1ccc(N2CCOCC2)cc1.CCCO |
| InChI | InChI=1S/C26H35F3N4O2.C3H8O/c1-19(2)18-23(32-24(26(27,28)29)20-6-4-3-5-7-20)25(34)31-13-12-30-21-8-10-22(11-9-21)33-14-16-35-17-15-33;1-2-3-4/h3-11,19,23-24,30,32H,12-18H2,1-2H3,(H,31,34);4H,2-3H2,1H3 |
| InChIKey | OJYOACBFEZZZGK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|