C34H53F3N4O3Si — CID 140543506
2-[[(1S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2,2,2-trifluoroethyl]amino]-4-methyl-N-[(2S)-1-(4-morpholin-4-ylanilino)butan-2-yl]pentanamide (PubChem CID 140543506) has the molecular formula C34H53F3N4O3Si and a molecular weight of 650.90 g/mol. Its IUPAC name is 2-[[(1S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2,2,2-trifluoroethyl]amino]-4-methyl-N-[(2S)-1-(4-morpholin-4-ylanilino)butan-2-yl]pentanamide.
| Compound Name | 2-[[(1S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2,2,2-trifluoroethyl]amino]-4-methyl-N-[(2S)-1-(4-morpholin-4-ylanilino)butan-2-yl]pentanamide |
|---|---|
| PubChem CID | 140543506 |
| Molecular Formula | C34H53F3N4O3Si |
| Molecular Weight | 650.90 g/mol |
| Exact Mass | 650.38 |
| IUPAC Name | 2-[[(1S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2,2,2-trifluoroethyl]amino]-4-methyl-N-[(2S)-1-(4-morpholin-4-ylanilino)butan-2-yl]pentanamide |
| SMILES | CC[C@@H](CNc1ccc(N2CCOCC2)cc1)NC(=O)C(CC(C)C)N[C@@H](c1ccc(O[Si](C)(C)C(C)(C)C)cc1)C(F)(F)F |
| InChI | InChI=1S/C34H53F3N4O3Si/c1-9-26(23-38-27-12-14-28(15-13-27)41-18-20-43-21-19-41)39-32(42)30(22-24(2)3)40-31(34(35,36)37)25-10-16-29(17-11-25)44-45(7,8)33(4,5)6/h10-17,24,26,30-31,38,40H,9,18-23H2,1-8H3,(H,39,42)/t26-,30?,31-/m0/s1 |
| InChIKey | XKLPEJPYCZXBIW-ZVKGIRIFSA-N |
| XLogP | 7.52 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.90 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|